C16H18O4 — CID 102343432
ethyl (1R,4R,5R)-4-methyl-7-oxo-5-phenyl-6-oxabicyclo[3.2.0]heptane-4-carboxylate (PubChem CID 102343432) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl (1R,4R,5R)-4-methyl-7-oxo-5-phenyl-6-oxabicyclo[3.2.0]heptane-4-carboxylate.
| Compound Name | ethyl (1R,4R,5R)-4-methyl-7-oxo-5-phenyl-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 102343432 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | ethyl (1R,4R,5R)-4-methyl-7-oxo-5-phenyl-6-oxabicyclo[3.2.0]heptane-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CC[C@H]2C(=O)O[C@@]21c1ccccc1 |
| InChI | InChI=1S/C16H18O4/c1-3-19-14(18)15(2)10-9-12-13(17)20-16(12,15)11-7-5-4-6-8-11/h4-8,12H,3,9-10H2,1-2H3/t12-,15-,16-/m0/s1 |
| InChIKey | CFYWWIKEBFUROD-RCBQFDQVSA-N |
| XLogP | 2.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|