C29H34O7 — CID 16719488
dibenzyl (2R,3S,4S)-4-(2-ethoxy-2-oxoethyl)-3-formyl-2-propylcyclopentane-1,1-dicarboxylate (PubChem CID 16719488) has the molecular formula C29H34O7 and a molecular weight of 494.58 g/mol. Its IUPAC name is dibenzyl (2R,3S,4S)-4-(2-ethoxy-2-oxoethyl)-3-formyl-2-propylcyclopentane-1,1-dicarboxylate.
| Compound Name | dibenzyl (2R,3S,4S)-4-(2-ethoxy-2-oxoethyl)-3-formyl-2-propylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 16719488 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | dibenzyl (2R,3S,4S)-4-(2-ethoxy-2-oxoethyl)-3-formyl-2-propylcyclopentane-1,1-dicarboxylate |
| SMILES | CCC[C@@H]1[C@@H](C=O)[C@H](CC(=O)OCC)CC1(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H34O7/c1-3-11-25-24(18-30)23(16-26(31)34-4-2)17-29(25,27(32)35-19-21-12-7-5-8-13-21)28(33)36-20-22-14-9-6-10-15-22/h5-10,12-15,18,23-25H,3-4,11,16-17,19-20H2,1-2H3/t23-,24+,25-/m1/s1 |
| InChIKey | NRKYFISMFLBKFU-DSNGMDLFSA-N |
| XLogP | 4.66 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|