C18H26O9 — CID 102343737
dimethyl 2-[(6R,9R)-9-(3-ethoxy-3-oxopropyl)-8-oxo-1,3-dioxaspiro[4.5]decan-6-yl]propanedioate (PubChem CID 102343737) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is dimethyl 2-[(6R,9R)-9-(3-ethoxy-3-oxopropyl)-8-oxo-1,3-dioxaspiro[4.5]decan-6-yl]propanedioate.
| Compound Name | dimethyl 2-[(6R,9R)-9-(3-ethoxy-3-oxopropyl)-8-oxo-1,3-dioxaspiro[4.5]decan-6-yl]propanedioate |
|---|---|
| PubChem CID | 102343737 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | dimethyl 2-[(6R,9R)-9-(3-ethoxy-3-oxopropyl)-8-oxo-1,3-dioxaspiro[4.5]decan-6-yl]propanedioate |
| SMILES | CCOC(=O)CC[C@@H]1CC2(COCO2)[C@@H](C(C(=O)OC)C(=O)OC)CC1=O |
| InChI | InChI=1S/C18H26O9/c1-4-26-14(20)6-5-11-8-18(9-25-10-27-18)12(7-13(11)19)15(16(21)23-2)17(22)24-3/h11-12,15H,4-10H2,1-3H3/t11-,12-,18?/m1/s1 |
| InChIKey | MQGHFWHKEXVMKY-FRCFAINYSA-N |
| XLogP | 0.63 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|