C18H32OSi — CID 102344034
[(2E,6E)-9-(2-ethenyloxiran-2-yl)-2,6-dimethylnona-2,6-dienyl]-trimethylsilane (PubChem CID 102344034) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is [(2E,6E)-9-(2-ethenyloxiran-2-yl)-2,6-dimethylnona-2,6-dienyl]-trimethylsilane.
| Compound Name | [(2E,6E)-9-(2-ethenyloxiran-2-yl)-2,6-dimethylnona-2,6-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 102344034 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | [(2E,6E)-9-(2-ethenyloxiran-2-yl)-2,6-dimethylnona-2,6-dienyl]-trimethylsilane |
| SMILES | C=CC1(CC/C=C(\C)CC/C=C(\C)C[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C18H32OSi/c1-7-18(15-19-18)13-9-12-16(2)10-8-11-17(3)14-20(4,5)6/h7,11-12H,1,8-10,13-15H2,2-6H3/b16-12+,17-11+ |
| InChIKey | MMQPMHXHVOMGRV-YJOMNHNESA-N |
| XLogP | 5.73 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|