C18H34OSi — CID 5366406
[(3E)-1-(3,3-dimethyloxiran-2-yl)-4,8-dimethylnona-3,7-dien-2-yl]-trimethylsilane (PubChem CID 5366406) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is [(3E)-1-(3,3-dimethyloxiran-2-yl)-4,8-dimethylnona-3,7-dien-2-yl]-trimethylsilane.
| Compound Name | [(3E)-1-(3,3-dimethyloxiran-2-yl)-4,8-dimethylnona-3,7-dien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 5366406 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | [(3E)-1-(3,3-dimethyloxiran-2-yl)-4,8-dimethylnona-3,7-dien-2-yl]-trimethylsilane |
| SMILES | CC(C)=CCC/C(C)=C/C(CC1OC1(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H34OSi/c1-14(2)10-9-11-15(3)12-16(20(6,7)8)13-17-18(4,5)19-17/h10,12,16-17H,9,11,13H2,1-8H3/b15-12+ |
| InChIKey | SJSBQDODADXHHI-NTCAYCPXSA-N |
| XLogP | 5.95 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|