C28H50O2Si — CID 11123187
(4E,8E,12E)-1-[tert-butyl(dimethyl)silyl]-15-[(2S)-3,3-dimethyloxiran-2-yl]-5,9,13-trimethylpentadeca-4,8,12-trien-1-one (PubChem CID 11123187) has the molecular formula C28H50O2Si and a molecular weight of 446.79 g/mol. Its IUPAC name is (4E,8E,12E)-1-[tert-butyl(dimethyl)silyl]-15-[(2S)-3,3-dimethyloxiran-2-yl]-5,9,13-trimethylpentadeca-4,8,12-trien-1-one.
| Compound Name | (4E,8E,12E)-1-[tert-butyl(dimethyl)silyl]-15-[(2S)-3,3-dimethyloxiran-2-yl]-5,9,13-trimethylpentadeca-4,8,12-trien-1-one |
|---|---|
| PubChem CID | 11123187 |
| Molecular Formula | C28H50O2Si |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | (4E,8E,12E)-1-[tert-butyl(dimethyl)silyl]-15-[(2S)-3,3-dimethyloxiran-2-yl]-5,9,13-trimethylpentadeca-4,8,12-trien-1-one |
| SMILES | C/C(=C\CCC(=O)[Si](C)(C)C(C)(C)C)CC/C=C(\C)CC/C=C(\C)CC[C@@H]1OC1(C)C |
| InChI | InChI=1S/C28H50O2Si/c1-22(16-12-17-24(3)20-21-25-28(7,8)30-25)14-11-15-23(2)18-13-19-26(29)31(9,10)27(4,5)6/h14,17-18,25H,11-13,15-16,19-21H2,1-10H3/b22-14+,23-18+,24-17+/t25-/m0/s1 |
| InChIKey | RJIXFXIWSFGEEK-ROJFZLLFSA-N |
| XLogP | 8.74 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|