C33H54OSi — CID 10939973
[(3Z,7E,11E,15E,19E)-22-(3,3-dimethyloxiran-2-yl)-7,11,16,20-tetramethyldocosa-3,7,11,15,19-pentaen-1-ynyl]-trimethylsilane (PubChem CID 10939973) has the molecular formula C33H54OSi and a molecular weight of 494.88 g/mol. Its IUPAC name is [(3Z,7E,11E,15E,19E)-22-(3,3-dimethyloxiran-2-yl)-7,11,16,20-tetramethyldocosa-3,7,11,15,19-pentaen-1-ynyl]-trimethylsilane.
| Compound Name | [(3Z,7E,11E,15E,19E)-22-(3,3-dimethyloxiran-2-yl)-7,11,16,20-tetramethyldocosa-3,7,11,15,19-pentaen-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10939973 |
| Molecular Formula | C33H54OSi |
| Molecular Weight | 494.88 g/mol |
| Exact Mass | 494.39 |
| IUPAC Name | [(3Z,7E,11E,15E,19E)-22-(3,3-dimethyloxiran-2-yl)-7,11,16,20-tetramethyldocosa-3,7,11,15,19-pentaen-1-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C)CC/C=C\C#C[Si](C)(C)C |
| InChI | InChI=1S/C33H54OSi/c1-28(18-12-10-11-15-27-35(7,8)9)21-16-22-29(2)19-13-14-20-30(3)23-17-24-31(4)25-26-32-33(5,6)34-32/h10-11,19-21,24,32H,12-14,16-18,22-23,25-26H2,1-9H3/b11-10-,28-21+,29-19+,30-20+,31-24+ |
| InChIKey | WHPADZKNCXDPMH-OWLHNRNTSA-N |
| XLogP | 10.29 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.88 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|