C35H59FOSi — CID 11006070
[(7Z,11Z,15E,19E)-22-(3,3-dimethyloxiran-2-yl)-12-fluoro-5,5,8,11,16,20-hexamethyldocosa-7,11,15,19-tetraen-2-ynyl]-trimethylsilane (PubChem CID 11006070) has the molecular formula C35H59FOSi and a molecular weight of 542.94 g/mol. Its IUPAC name is [(7Z,11Z,15E,19E)-22-(3,3-dimethyloxiran-2-yl)-12-fluoro-5,5,8,11,16,20-hexamethyldocosa-7,11,15,19-tetraen-2-ynyl]-trimethylsilane.
| Compound Name | [(7Z,11Z,15E,19E)-22-(3,3-dimethyloxiran-2-yl)-12-fluoro-5,5,8,11,16,20-hexamethyldocosa-7,11,15,19-tetraen-2-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11006070 |
| Molecular Formula | C35H59FOSi |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.43 |
| IUPAC Name | [(7Z,11Z,15E,19E)-22-(3,3-dimethyloxiran-2-yl)-12-fluoro-5,5,8,11,16,20-hexamethyldocosa-7,11,15,19-tetraen-2-ynyl]-trimethylsilane |
| SMILES | C/C(=C/CC(C)(C)CC#CC[Si](C)(C)C)CC/C(C)=C(\F)CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C35H59FOSi/c1-28(16-14-17-29(2)21-23-33-35(7,8)37-33)18-15-19-32(36)31(4)22-20-30(3)24-26-34(5,6)25-12-13-27-38(9,10)11/h17-18,24,33H,14-16,19-23,25-27H2,1-11H3/b28-18+,29-17+,30-24-,32-31- |
| InChIKey | IOIBIZBJCDEPRC-YZGSPHPASA-N |
| XLogP | 11.52 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|