C22H38OSi — CID 11002515
[(6E,10E)-13-(3,3-dimethyloxiran-2-yl)-7,11-dimethyltrideca-6,10-dien-2-ynyl]-trimethylsilane (PubChem CID 11002515) has the molecular formula C22H38OSi and a molecular weight of 346.63 g/mol. Its IUPAC name is [(6E,10E)-13-(3,3-dimethyloxiran-2-yl)-7,11-dimethyltrideca-6,10-dien-2-ynyl]-trimethylsilane.
| Compound Name | [(6E,10E)-13-(3,3-dimethyloxiran-2-yl)-7,11-dimethyltrideca-6,10-dien-2-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11002515 |
| Molecular Formula | C22H38OSi |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | [(6E,10E)-13-(3,3-dimethyloxiran-2-yl)-7,11-dimethyltrideca-6,10-dien-2-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CCC#CC[Si](C)(C)C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C22H38OSi/c1-19(13-10-8-9-11-18-24(5,6)7)14-12-15-20(2)16-17-21-22(3,4)23-21/h13,15,21H,8,10,12,14,16-18H2,1-7H3/b19-13+,20-15+ |
| InChIKey | MGFFWIYOPVFBAW-YLYRKCBPSA-N |
| XLogP | 6.74 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|