C20H36O2Si — CID 11302135
tert-butyl-dimethyl-[[(2S,3S)-2-methyl-3-[(E)-3-methylnon-3-en-8-ynyl]oxiran-2-yl]methoxy]silane (PubChem CID 11302135) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,3S)-2-methyl-3-[(E)-3-methylnon-3-en-8-ynyl]oxiran-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,3S)-2-methyl-3-[(E)-3-methylnon-3-en-8-ynyl]oxiran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11302135 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,3S)-2-methyl-3-[(E)-3-methylnon-3-en-8-ynyl]oxiran-2-yl]methoxy]silane |
| SMILES | C#CCCC/C=C(\C)CC[C@@H]1O[C@@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O2Si/c1-9-10-11-12-13-17(2)14-15-18-20(6,22-18)16-21-23(7,8)19(3,4)5/h1,13,18H,10-12,14-16H2,2-8H3/b17-13+/t18-,20-/m0/s1 |
| InChIKey | AZXSDAOFBAMZSB-WHYSNAIBSA-N |
| XLogP | 5.70 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|