C27H50O2Si — CID 10502992
tert-butyl-[(3E,7E,11E)-14-(3,3-dimethyloxiran-2-yl)-3,8,12-trimethyltetradeca-3,7,11-trienoxy]-dimethylsilane (PubChem CID 10502992) has the molecular formula C27H50O2Si and a molecular weight of 434.78 g/mol. Its IUPAC name is tert-butyl-[(3E,7E,11E)-14-(3,3-dimethyloxiran-2-yl)-3,8,12-trimethyltetradeca-3,7,11-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3E,7E,11E)-14-(3,3-dimethyloxiran-2-yl)-3,8,12-trimethyltetradeca-3,7,11-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10502992 |
| Molecular Formula | C27H50O2Si |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | tert-butyl-[(3E,7E,11E)-14-(3,3-dimethyloxiran-2-yl)-3,8,12-trimethyltetradeca-3,7,11-trienoxy]-dimethylsilane |
| SMILES | C/C(=C\CC/C=C(\C)CCO[Si](C)(C)C(C)(C)C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C27H50O2Si/c1-22(16-13-17-23(2)18-19-25-27(7,8)29-25)14-11-12-15-24(3)20-21-28-30(9,10)26(4,5)6/h14-15,17,25H,11-13,16,18-21H2,1-10H3/b22-14+,23-17+,24-15+ |
| InChIKey | DRWSJMFFPQXDBP-IBRXCPKVSA-N |
| XLogP | 8.76 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|