C28H46OSi — CID 10862849
[(3E,7E,11E,15E)-18-(3,3-dimethyloxiran-2-yl)-7,12,16-trimethyloctadeca-3,7,11,15-tetraen-1-ynyl]-trimethylsilane (PubChem CID 10862849) has the molecular formula C28H46OSi and a molecular weight of 426.76 g/mol. Its IUPAC name is [(3E,7E,11E,15E)-18-(3,3-dimethyloxiran-2-yl)-7,12,16-trimethyloctadeca-3,7,11,15-tetraen-1-ynyl]-trimethylsilane.
| Compound Name | [(3E,7E,11E,15E)-18-(3,3-dimethyloxiran-2-yl)-7,12,16-trimethyloctadeca-3,7,11,15-tetraen-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10862849 |
| Molecular Formula | C28H46OSi |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | [(3E,7E,11E,15E)-18-(3,3-dimethyloxiran-2-yl)-7,12,16-trimethyloctadeca-3,7,11,15-tetraen-1-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C)CC/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C28H46OSi/c1-24(16-11-9-10-14-23-30(6,7)8)17-12-13-18-25(2)19-15-20-26(3)21-22-27-28(4,5)29-27/h9-10,17-18,20,27H,11-13,15-16,19,21-22H2,1-8H3/b10-9+,24-17+,25-18+,26-20+ |
| InChIKey | LTLAHELNUZVCCL-GTOMDJGTSA-N |
| XLogP | 8.56 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|