C17H30OSi — CID 10612662
[(E)-9-(3,3-dimethyloxiran-2-yl)-7-methylnon-6-en-2-ynyl]-trimethylsilane (PubChem CID 10612662) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is [(E)-9-(3,3-dimethyloxiran-2-yl)-7-methylnon-6-en-2-ynyl]-trimethylsilane.
| Compound Name | [(E)-9-(3,3-dimethyloxiran-2-yl)-7-methylnon-6-en-2-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10612662 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [(E)-9-(3,3-dimethyloxiran-2-yl)-7-methylnon-6-en-2-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CCC#CC[Si](C)(C)C)CCC1OC1(C)C |
| InChI | InChI=1S/C17H30OSi/c1-15(12-13-16-17(2,3)18-16)11-9-7-8-10-14-19(4,5)6/h11,16H,7,9,12-14H2,1-6H3/b15-11+ |
| InChIKey | JESOPANBDSUUSA-RVDMUPIBSA-N |
| XLogP | 5.01 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|