C15H26OSi — CID 138983337
[(E)-7-(3,3-dimethyloxiran-2-yl)-6-methylhept-5-en-1-ynyl]-trimethylsilane (PubChem CID 138983337) has the molecular formula C15H26OSi and a molecular weight of 250.46 g/mol. Its IUPAC name is [(E)-7-(3,3-dimethyloxiran-2-yl)-6-methylhept-5-en-1-ynyl]-trimethylsilane.
| Compound Name | [(E)-7-(3,3-dimethyloxiran-2-yl)-6-methylhept-5-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 138983337 |
| Molecular Formula | C15H26OSi |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | [(E)-7-(3,3-dimethyloxiran-2-yl)-6-methylhept-5-en-1-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CCC#C[Si](C)(C)C)CC1OC1(C)C |
| InChI | InChI=1S/C15H26OSi/c1-13(12-14-15(2,3)16-14)10-8-7-9-11-17(4,5)6/h10,14H,7-8,12H2,1-6H3/b13-10+ |
| InChIKey | ICNNKKYYYASZNY-JLHYYAGUSA-N |
| XLogP | 4.16 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|