C12H20OSi — CID 12062493
2-[(2R,3S)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane (PubChem CID 12062493) has the molecular formula C12H20OSi and a molecular weight of 208.38 g/mol. Its IUPAC name is 2-[(2R,3S)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2R,3S)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 12062493 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-[(2R,3S)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane |
| SMILES | C=CCC[C@@H]1O[C@]1(C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H20OSi/c1-6-7-8-11-12(2,13-11)9-10-14(3,4)5/h6,11H,1,7-8H2,2-5H3/t11-,12+/m0/s1 |
| InChIKey | PKQMHMWYVBBVKY-NWDGAFQWSA-N |
| XLogP | 2.99 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|