About 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane
2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane (PubChem CID 101261656) has the molecular formula C12H20OSi
and a molecular weight of 208.38 g/mol. Its IUPAC name is 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane |
| PubChem CID | 101261656 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane |
| SMILES | C=CCC[C@H]1O[C@@]1(C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H20OSi/c1-6-7-8-11-12(2,13-11)9-10-14(3,4)5/h6,11H,1,7-8H2,2-5H3/t11-,12+/m1/s1 |
| InChIKey | PKQMHMWYVBBVKY-NEPJUHHUSA-N |
| XLogP | 2.99 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane?
The IUPAC name of 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane (CID 101261656) is 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane.
What is the SMILES notation for 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane?
The canonical SMILES for 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane is C=CCC[C@H]1O[C@@]1(C)C#C[Si](C)(C)C.
What is the InChIKey of 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane?
The InChIKey is PKQMHMWYVBBVKY-NEPJUHHUSA-N. The full InChI is InChI=1S/C12H20OSi/c1-6-7-8-11-12(2,13-11)9-10-14(3,4)5/h6,11H,1,7-8H2,2-5H3/t11-,12+/m1/s1.
What are the key properties of 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane?
2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane has a molecular weight of 208.38 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,3R)-3-but-3-enyl-2-methyloxiran-2-yl]ethynyl-trimethylsilane is sourced from PubChem (CID 101261656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).