C34H56OSi — CID 11049466
[(4E,8E,12E,16E)-19-(3,3-dimethyloxiran-2-yl)-8,13,17-trimethyl-4-(3-methylbut-2-enyl)nonadeca-4,8,12,16-tetraen-1-ynyl]-trimethylsilane (PubChem CID 11049466) has the molecular formula C34H56OSi and a molecular weight of 508.91 g/mol. Its IUPAC name is [(4E,8E,12E,16E)-19-(3,3-dimethyloxiran-2-yl)-8,13,17-trimethyl-4-(3-methylbut-2-enyl)nonadeca-4,8,12,16-tetraen-1-ynyl]-trimethylsilane.
| Compound Name | [(4E,8E,12E,16E)-19-(3,3-dimethyloxiran-2-yl)-8,13,17-trimethyl-4-(3-methylbut-2-enyl)nonadeca-4,8,12,16-tetraen-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11049466 |
| Molecular Formula | C34H56OSi |
| Molecular Weight | 508.91 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | [(4E,8E,12E,16E)-19-(3,3-dimethyloxiran-2-yl)-8,13,17-trimethyl-4-(3-methylbut-2-enyl)nonadeca-4,8,12,16-tetraen-1-ynyl]-trimethylsilane |
| SMILES | CC(C)=CC/C(=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C34H56OSi/c1-28(2)23-25-32(22-15-27-36(8,9)10)21-14-20-30(4)17-12-11-16-29(3)18-13-19-31(5)24-26-33-34(6,7)35-33/h16-17,19,21,23,33H,11-14,18,20,22,24-26H2,1-10H3/b29-16+,30-17+,31-19+,32-21- |
| InChIKey | YQSOZUKCXFKDQB-RDZUMRBDSA-N |
| XLogP | 10.68 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.91 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|