C23H42OSi — CID 11783414
[(2Z,6E)-9-(3,3-dimethyloxiran-2-yl)-7-methyl-2-(4-methylpent-3-enyl)nona-2,6-dienyl]-trimethylsilane (PubChem CID 11783414) has the molecular formula C23H42OSi and a molecular weight of 362.67 g/mol. Its IUPAC name is [(2Z,6E)-9-(3,3-dimethyloxiran-2-yl)-7-methyl-2-(4-methylpent-3-enyl)nona-2,6-dienyl]-trimethylsilane.
| Compound Name | [(2Z,6E)-9-(3,3-dimethyloxiran-2-yl)-7-methyl-2-(4-methylpent-3-enyl)nona-2,6-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 11783414 |
| Molecular Formula | C23H42OSi |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | [(2Z,6E)-9-(3,3-dimethyloxiran-2-yl)-7-methyl-2-(4-methylpent-3-enyl)nona-2,6-dienyl]-trimethylsilane |
| SMILES | CC(C)=CCC/C(=C/CC/C=C(\C)CCC1OC1(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C23H42OSi/c1-19(2)12-11-15-21(18-25(6,7)8)14-10-9-13-20(3)16-17-22-23(4,5)24-22/h12-14,22H,9-11,15-18H2,1-8H3/b20-13+,21-14- |
| InChIKey | MAMVLIGOOMXROZ-NAWSQEDCSA-N |
| XLogP | 7.68 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|