C30H52O2Si — CID 24885916
tert-butyl-[(7E,11E,15E)-18-[(2S)-3,3-dimethyloxiran-2-yl]-12,16-dimethyloctadeca-7,11,15-trien-3-yn-8-yl]oxy-dimethylsilane (PubChem CID 24885916) has the molecular formula C30H52O2Si and a molecular weight of 472.83 g/mol. Its IUPAC name is tert-butyl-[(7E,11E,15E)-18-[(2S)-3,3-dimethyloxiran-2-yl]-12,16-dimethyloctadeca-7,11,15-trien-3-yn-8-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(7E,11E,15E)-18-[(2S)-3,3-dimethyloxiran-2-yl]-12,16-dimethyloctadeca-7,11,15-trien-3-yn-8-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 24885916 |
| Molecular Formula | C30H52O2Si |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.37 |
| IUPAC Name | tert-butyl-[(7E,11E,15E)-18-[(2S)-3,3-dimethyloxiran-2-yl]-12,16-dimethyloctadeca-7,11,15-trien-3-yn-8-yl]oxy-dimethylsilane |
| SMILES | CCC#CCC/C=C(\CC/C=C(\C)CC/C=C(\C)CC[C@@H]1OC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H52O2Si/c1-11-12-13-14-15-21-27(32-33(9,10)29(4,5)6)22-17-20-25(2)18-16-19-26(3)23-24-28-30(7,8)31-28/h19-21,28H,11,14-18,22-24H2,1-10H3/b25-20+,26-19+,27-21+/t28-/m0/s1 |
| InChIKey | WNYOHQBOCINLJC-CWPGWYQGSA-N |
| XLogP | 9.50 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|