C31H35NO — CID 102345828
2,6-ditert-butyl-4-[3-[4-(dimethylamino)phenyl]inden-1-ylidene]cyclohexa-2,5-dien-1-one (PubChem CID 102345828) has the molecular formula C31H35NO and a molecular weight of 437.63 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[3-[4-(dimethylamino)phenyl]inden-1-ylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[3-[4-(dimethylamino)phenyl]inden-1-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 102345828 |
| Molecular Formula | C31H35NO |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[3-[4-(dimethylamino)phenyl]inden-1-ylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CN(C)c1ccc(C2=CC(=C3C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H35NO/c1-30(2,3)27-17-21(18-28(29(27)33)31(4,5)6)26-19-25(23-11-9-10-12-24(23)26)20-13-15-22(16-14-20)32(7)8/h9-19H,1-8H3 |
| InChIKey | VRWWXDDGYNSVKF-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|