C16H28O3 — CID 102346040
4-(1-hydroxydodecyl)-2H-furan-5-one (PubChem CID 102346040) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-(1-hydroxydodecyl)-2H-furan-5-one.
| Compound Name | 4-(1-hydroxydodecyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 102346040 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 4-(1-hydroxydodecyl)-2H-furan-5-one |
| SMILES | CCCCCCCCCCCC(O)C1=CCOC1=O |
| InChI | InChI=1S/C16H28O3/c1-2-3-4-5-6-7-8-9-10-11-15(17)14-12-13-19-16(14)18/h12,15,17H,2-11,13H2,1H3 |
| InChIKey | GVLMKAFQCJZPJC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|