C21H15NO6S — CID 102346979
4-(2-methoxyanilino)-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 102346979) has the molecular formula C21H15NO6S and a molecular weight of 409.42 g/mol. Its IUPAC name is 4-(2-methoxyanilino)-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 4-(2-methoxyanilino)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 102346979 |
| Molecular Formula | C21H15NO6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 4-(2-methoxyanilino)-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | COc1ccccc1Nc1cc(S(=O)(=O)O)cc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H15NO6S/c1-28-18-9-5-4-8-16(18)22-17-11-12(29(25,26)27)10-15-19(17)21(24)14-7-3-2-6-13(14)20(15)23/h2-11,22H,1H3,(H,25,26,27) |
| InChIKey | WEMQUUXLGGGNHY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|