C44H56N2O2 — CID 102347773
2-(ethylamino)-5-[2-[2-[2-[4-(ethylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]ethynyl]-4,5-dioctylphenyl]ethynyl]cyclohepta-2,4,6-trien-1-one (PubChem CID 102347773) has the molecular formula C44H56N2O2 and a molecular weight of 644.94 g/mol. Its IUPAC name is 2-(ethylamino)-5-[2-[2-[2-[4-(ethylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]ethynyl]-4,5-dioctylphenyl]ethynyl]cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-(ethylamino)-5-[2-[2-[2-[4-(ethylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]ethynyl]-4,5-dioctylphenyl]ethynyl]cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 102347773 |
| Molecular Formula | C44H56N2O2 |
| Molecular Weight | 644.94 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | 2-(ethylamino)-5-[2-[2-[2-[4-(ethylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]ethynyl]-4,5-dioctylphenyl]ethynyl]cyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCCCCCc1cc(C#Cc2ccc(NCC)c(=O)cc2)c(C#Cc2ccc(NCC)c(=O)cc2)cc1CCCCCCCC |
| InChI | InChI=1S/C44H56N2O2/c1-5-9-11-13-15-17-19-37-33-39(27-21-35-23-29-41(45-7-3)43(47)31-25-35)40(34-38(37)20-18-16-14-12-10-6-2)28-22-36-24-30-42(46-8-4)44(48)32-26-36/h23-26,29-34H,5-20H2,1-4H3,(H,45,47)(H,46,48) |
| InChIKey | FHEIAJRRONPWIT-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.94 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|