C37H41BrO3 — CID 102379828
[4-[2-[2,5-dihexyl-4-[2-(4-hydroxyphenyl)ethynyl]phenyl]ethynyl]phenyl] 2-bromopropanoate (PubChem CID 102379828) has the molecular formula C37H41BrO3 and a molecular weight of 613.64 g/mol. Its IUPAC name is [4-[2-[2,5-dihexyl-4-[2-(4-hydroxyphenyl)ethynyl]phenyl]ethynyl]phenyl] 2-bromopropanoate.
| Compound Name | [4-[2-[2,5-dihexyl-4-[2-(4-hydroxyphenyl)ethynyl]phenyl]ethynyl]phenyl] 2-bromopropanoate |
|---|---|
| PubChem CID | 102379828 |
| Molecular Formula | C37H41BrO3 |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | [4-[2-[2,5-dihexyl-4-[2-(4-hydroxyphenyl)ethynyl]phenyl]ethynyl]phenyl] 2-bromopropanoate |
| SMILES | CCCCCCc1cc(C#Cc2ccc(OC(=O)C(C)Br)cc2)c(CCCCCC)cc1C#Cc1ccc(O)cc1 |
| InChI | InChI=1S/C37H41BrO3/c1-4-6-8-10-12-31-27-34(21-15-30-18-24-36(25-19-30)41-37(40)28(3)38)32(13-11-9-7-5-2)26-33(31)20-14-29-16-22-35(39)23-17-29/h16-19,22-28,39H,4-13H2,1-3H3 |
| InChIKey | LVYSEVOHJSNGAX-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|