C62H90O2Si — CID 10819526
2-[4-[2-[2,5-dihexyl-4-[2-[4-(oxan-2-yloxy)phenyl]ethynyl]phenyl]ethynyl]-2,5-dihexylphenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 10819526) has the molecular formula C62H90O2Si and a molecular weight of 895.49 g/mol. Its IUPAC name is 2-[4-[2-[2,5-dihexyl-4-[2-[4-(oxan-2-yloxy)phenyl]ethynyl]phenyl]ethynyl]-2,5-dihexylphenyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[4-[2-[2,5-dihexyl-4-[2-[4-(oxan-2-yloxy)phenyl]ethynyl]phenyl]ethynyl]-2,5-dihexylphenyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10819526 |
| Molecular Formula | C62H90O2Si |
| Molecular Weight | 895.49 g/mol |
| Exact Mass | 894.67 |
| IUPAC Name | 2-[4-[2-[2,5-dihexyl-4-[2-[4-(oxan-2-yloxy)phenyl]ethynyl]phenyl]ethynyl]-2,5-dihexylphenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CCCCCCc1cc(C#Cc2cc(CCCCCC)c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc2CCCCCC)c(CCCCCC)cc1C#Cc1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C62H90O2Si/c1-11-15-19-23-29-53-46-58(54(30-24-20-16-12-2)45-57(53)37-34-52-35-40-61(41-36-52)64-62-33-27-28-43-63-62)38-39-59-47-56(32-26-22-18-14-4)60(48-55(59)31-25-21-17-13-3)42-44-65(49(5)6,50(7)8)51(9)10/h35-36,40-41,45-51,62H,11-33,43H2,1-10H3 |
| InChIKey | ZGDQDBLSSOVYGY-UHFFFAOYSA-N |
| XLogP | 17.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.49 |
| LogP ≤ 5 | 17.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|