C21H20F2O3 — CID 177389117
2-[4-[2-(4-ethoxyphenyl)ethynyl]-2,3-difluorophenoxy]oxane (PubChem CID 177389117) has the molecular formula C21H20F2O3 and a molecular weight of 358.38 g/mol. Its IUPAC name is 2-[4-[2-(4-ethoxyphenyl)ethynyl]-2,3-difluorophenoxy]oxane.
| Compound Name | 2-[4-[2-(4-ethoxyphenyl)ethynyl]-2,3-difluorophenoxy]oxane |
|---|---|
| PubChem CID | 177389117 |
| Molecular Formula | C21H20F2O3 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[4-[2-(4-ethoxyphenyl)ethynyl]-2,3-difluorophenoxy]oxane |
| SMILES | CCOc1ccc(C#Cc2ccc(OC3CCCCO3)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H20F2O3/c1-2-24-17-11-7-15(8-12-17)6-9-16-10-13-18(21(23)20(16)22)26-19-5-3-4-14-25-19/h7-8,10-13,19H,2-5,14H2,1H3 |
| InChIKey | MZAAGUFBUXLRPQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|