C22H24O2 — CID 22976479
[4-[2-(2,4,5-trimethylphenyl)ethynyl]phenyl] 2-methylbutanoate (PubChem CID 22976479) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is [4-[2-(2,4,5-trimethylphenyl)ethynyl]phenyl] 2-methylbutanoate.
| Compound Name | [4-[2-(2,4,5-trimethylphenyl)ethynyl]phenyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 22976479 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | [4-[2-(2,4,5-trimethylphenyl)ethynyl]phenyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1ccc(C#Cc2cc(C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C22H24O2/c1-6-15(2)22(23)24-21-11-8-19(9-12-21)7-10-20-14-17(4)16(3)13-18(20)5/h8-9,11-15H,6H2,1-5H3 |
| InChIKey | WLJODZAZCVOUJR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|