C39H33NO3 — CID 90050184
[4-[4-[4-[4-(4-cyanophenyl)-3-methylphenyl]-2-methylphenyl]benzoyl]phenyl] 2-methylbutanoate (PubChem CID 90050184) has the molecular formula C39H33NO3 and a molecular weight of 563.70 g/mol. Its IUPAC name is [4-[4-[4-[4-(4-cyanophenyl)-3-methylphenyl]-2-methylphenyl]benzoyl]phenyl] 2-methylbutanoate.
| Compound Name | [4-[4-[4-[4-(4-cyanophenyl)-3-methylphenyl]-2-methylphenyl]benzoyl]phenyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 90050184 |
| Molecular Formula | C39H33NO3 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | [4-[4-[4-[4-(4-cyanophenyl)-3-methylphenyl]-2-methylphenyl]benzoyl]phenyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1ccc(C(=O)c2ccc(-c3ccc(-c4ccc(-c5ccc(C#N)cc5)c(C)c4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C39H33NO3/c1-5-25(2)39(42)43-35-18-14-32(15-19-35)38(41)31-12-10-30(11-13-31)37-21-17-34(23-27(37)4)33-16-20-36(26(3)22-33)29-8-6-28(24-40)7-9-29/h6-23,25H,5H2,1-4H3 |
| InChIKey | UCKMODZXVXLVQP-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|