C22H29NO3 — CID 102351350
ethyl (1R,5R)-9-oxo-3-[(1S)-1-phenylethyl]-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 102351350) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is ethyl (1R,5R)-9-oxo-3-[(1S)-1-phenylethyl]-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | ethyl (1R,5R)-9-oxo-3-[(1S)-1-phenylethyl]-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 102351350 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | ethyl (1R,5R)-9-oxo-3-[(1S)-1-phenylethyl]-5-prop-2-enyl-3-azabicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | C=CC[C@]12CCC[C@@](C(=O)OCC)(CN([C@@H](C)c3ccccc3)C1)C2=O |
| InChI | InChI=1S/C22H29NO3/c1-4-12-21-13-9-14-22(19(21)24,20(25)26-5-2)16-23(15-21)17(3)18-10-7-6-8-11-18/h4,6-8,10-11,17H,1,5,9,12-16H2,2-3H3/t17-,21-,22+/m0/s1 |
| InChIKey | NFRNCYLFKLTUMN-BULFRSBZSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|