C14H20O — CID 102355175
(1R,2S,5R,6R,7R)-2,7-dimethyltricyclo[5.2.2.01,5]undec-8-ene-6-carbaldehyde (PubChem CID 102355175) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (1R,2S,5R,6R,7R)-2,7-dimethyltricyclo[5.2.2.01,5]undec-8-ene-6-carbaldehyde.
| Compound Name | (1R,2S,5R,6R,7R)-2,7-dimethyltricyclo[5.2.2.01,5]undec-8-ene-6-carbaldehyde |
|---|---|
| PubChem CID | 102355175 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1R,2S,5R,6R,7R)-2,7-dimethyltricyclo[5.2.2.01,5]undec-8-ene-6-carbaldehyde |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](C=O)[C@@]3(C)C=C[C@]21CC3 |
| InChI | InChI=1S/C14H20O/c1-10-3-4-11-12(9-15)13(2)5-7-14(10,11)8-6-13/h5,7,9-12H,3-4,6,8H2,1-2H3/t10-,11+,12+,13-,14+/m0/s1 |
| InChIKey | WFOGAKPGWBRYHS-MQLXINIDSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|