C12H20O9 — CID 102357830
methyl (2R,3R,3aR,5R,6R,6aR)-5-(dimethoxymethyl)-3,5-dihydroxy-2-(hydroxymethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-carboxylate (PubChem CID 102357830) has the molecular formula C12H20O9 and a molecular weight of 308.28 g/mol. Its IUPAC name is methyl (2R,3R,3aR,5R,6R,6aR)-5-(dimethoxymethyl)-3,5-dihydroxy-2-(hydroxymethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-carboxylate.
| Compound Name | methyl (2R,3R,3aR,5R,6R,6aR)-5-(dimethoxymethyl)-3,5-dihydroxy-2-(hydroxymethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-carboxylate |
|---|---|
| PubChem CID | 102357830 |
| Molecular Formula | C12H20O9 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | methyl (2R,3R,3aR,5R,6R,6aR)-5-(dimethoxymethyl)-3,5-dihydroxy-2-(hydroxymethyl)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2O[C@H](CO)[C@@H](O)[C@H]2O[C@@]1(O)C(OC)OC |
| InChI | InChI=1S/C12H20O9/c1-17-10(15)6-8-9(7(14)5(4-13)20-8)21-12(6,16)11(18-2)19-3/h5-9,11,13-14,16H,4H2,1-3H3/t5-,6+,7-,8-,9-,12-/m1/s1 |
| InChIKey | PWWHPVKACYJUOD-PRYPKFTLSA-N |
| XLogP | -2.40 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|