C18H12F13NO3 — CID 102357865
ethyl 2-cyano-2-[4-methoxy-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]acetate (PubChem CID 102357865) has the molecular formula C18H12F13NO3 and a molecular weight of 537.27 g/mol. Its IUPAC name is ethyl 2-cyano-2-[4-methoxy-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]acetate.
| Compound Name | ethyl 2-cyano-2-[4-methoxy-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]acetate |
|---|---|
| PubChem CID | 102357865 |
| Molecular Formula | C18H12F13NO3 |
| Molecular Weight | 537.27 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | ethyl 2-cyano-2-[4-methoxy-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]acetate |
| SMILES | CCOC(=O)C(C#N)c1ccc(OC)cc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H12F13NO3/c1-3-35-12(33)10(7-32)9-5-4-8(34-2)6-11(9)13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h4-6,10H,3H2,1-2H3 |
| InChIKey | NCMCYUWEYVVSIE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.27 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|