C59H50N4O2P2 — CID 102359066
3-diphenylphosphanyl-N-[2-[1-[7-[(3-diphenylphosphanylbenzoyl)amino]-3-methyl-1H-indol-2-yl]propyl]-3-methyl-1H-indol-7-yl]benzamide (PubChem CID 102359066) has the molecular formula C59H50N4O2P2 and a molecular weight of 909.02 g/mol. Its IUPAC name is 3-diphenylphosphanyl-N-[2-[1-[7-[(3-diphenylphosphanylbenzoyl)amino]-3-methyl-1H-indol-2-yl]propyl]-3-methyl-1H-indol-7-yl]benzamide.
| Compound Name | 3-diphenylphosphanyl-N-[2-[1-[7-[(3-diphenylphosphanylbenzoyl)amino]-3-methyl-1H-indol-2-yl]propyl]-3-methyl-1H-indol-7-yl]benzamide |
|---|---|
| PubChem CID | 102359066 |
| Molecular Formula | C59H50N4O2P2 |
| Molecular Weight | 909.02 g/mol |
| Exact Mass | 908.34 |
| IUPAC Name | 3-diphenylphosphanyl-N-[2-[1-[7-[(3-diphenylphosphanylbenzoyl)amino]-3-methyl-1H-indol-2-yl]propyl]-3-methyl-1H-indol-7-yl]benzamide |
| SMILES | CCC(c1[nH]c2c(NC(=O)c3cccc(P(c4ccccc4)c4ccccc4)c3)cccc2c1C)c1[nH]c2c(NC(=O)c3cccc(P(c4ccccc4)c4ccccc4)c3)cccc2c1C |
| InChI | InChI=1S/C59H50N4O2P2/c1-4-49(54-39(2)50-33-19-35-52(56(50)62-54)60-58(64)41-21-17-31-47(37-41)66(43-23-9-5-10-24-43)44-25-11-6-12-26-44)55-40(3)51-34-20-36-53(57(51)63-55)61-59(65)42-22-18-32-48(38-42)67(45-27-13-7-14-28-45)46-29-15-8-16-30-46/h5-38,49,62-63H,4H2,1-3H3,(H,60,64)(H,61,65) |
| InChIKey | VXIZNDRZWVVVAZ-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.02 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|