C9H11ClN4O4 — CID 102361036
(E)-3-chloro-N-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]prop-2-enamide (PubChem CID 102361036) has the molecular formula C9H11ClN4O4 and a molecular weight of 274.66 g/mol. Its IUPAC name is (E)-3-chloro-N-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-chloro-N-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 102361036 |
| Molecular Formula | C9H11ClN4O4 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (E)-3-chloro-N-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]prop-2-enamide |
| SMILES | O=C(/C=C/Cl)NCC(O)Cn1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11ClN4O4/c10-2-1-8(16)12-5-7(15)6-13-4-3-11-9(13)14(17)18/h1-4,7,15H,5-6H2,(H,12,16)/b2-1+ |
| InChIKey | WLWOWMSJKZXJKE-OWOJBTEDSA-N |
| XLogP | 0.02 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|