C9H9F6N3O4 — CID 21111679
1-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-3-(2-nitroimidazol-1-yl)propan-2-ol (PubChem CID 21111679) has the molecular formula C9H9F6N3O4 and a molecular weight of 337.18 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-3-(2-nitroimidazol-1-yl)propan-2-ol.
| Compound Name | 1-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-3-(2-nitroimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 21111679 |
| Molecular Formula | C9H9F6N3O4 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-3-(2-nitroimidazol-1-yl)propan-2-ol |
| SMILES | O=[N+]([O-])c1nccn1CC(O)COC(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H9F6N3O4/c10-6(11)8(12,9(13,14)15)22-4-5(19)3-17-2-1-16-7(17)18(20)21/h1-2,5-6,19H,3-4H2 |
| InChIKey | APCUCTKVKGOQRK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|