C52H54Cl2N4O4S — CID 102361337
4-[(E)-2-(3-chloro-4-octoxyphenyl)ethenyl]-N-[5-[[4-[(E)-2-(3-chloro-4-octoxyphenyl)ethenyl]benzoyl]amino]-3,4-dicyanothiophen-2-yl]benzamide (PubChem CID 102361337) has the molecular formula C52H54Cl2N4O4S and a molecular weight of 902.00 g/mol. Its IUPAC name is 4-[(E)-2-(3-chloro-4-octoxyphenyl)ethenyl]-N-[5-[[4-[(E)-2-(3-chloro-4-octoxyphenyl)ethenyl]benzoyl]amino]-3,4-dicyanothiophen-2-yl]benzamide.
| Compound Name | 4-[(E)-2-(3-chloro-4-octoxyphenyl)ethenyl]-N-[5-[[4-[(E)-2-(3-chloro-4-octoxyphenyl)ethenyl]benzoyl]amino]-3,4-dicyanothiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 102361337 |
| Molecular Formula | C52H54Cl2N4O4S |
| Molecular Weight | 902.00 g/mol |
| Exact Mass | 900.32 |
| IUPAC Name | 4-[(E)-2-(3-chloro-4-octoxyphenyl)ethenyl]-N-[5-[[4-[(E)-2-(3-chloro-4-octoxyphenyl)ethenyl]benzoyl]amino]-3,4-dicyanothiophen-2-yl]benzamide |
| SMILES | CCCCCCCCOc1ccc(/C=C/c2ccc(C(=O)Nc3sc(NC(=O)c4ccc(/C=C/c5ccc(OCCCCCCCC)c(Cl)c5)cc4)c(C#N)c3C#N)cc2)cc1Cl |
| InChI | InChI=1S/C52H54Cl2N4O4S/c1-3-5-7-9-11-13-31-61-47-29-23-39(33-45(47)53)17-15-37-19-25-41(26-20-37)49(59)57-51-43(35-55)44(36-56)52(63-51)58-50(60)42-27-21-38(22-28-42)16-18-40-24-30-48(46(54)34-40)62-32-14-12-10-8-6-4-2/h15-30,33-34H,3-14,31-32H2,1-2H3,(H,57,59)(H,58,60)/b17-15+,18-16+ |
| InChIKey | RNMWTOXBCIDNNO-YTEMWHBBSA-N |
| XLogP | 15.12 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.00 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|