C17H18N4O — CID 10236439
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-ethynylpyrrolo[1,2-c]pyrimidine-3-carboxamide (PubChem CID 10236439) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-ethynylpyrrolo[1,2-c]pyrimidine-3-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-ethynylpyrrolo[1,2-c]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 10236439 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-ethynylpyrrolo[1,2-c]pyrimidine-3-carboxamide |
| SMILES | C#Cc1ccc2cc(C(=O)N[C@H]3CN4CCC3CC4)ncn12 |
| InChI | InChI=1S/C17H18N4O/c1-2-13-3-4-14-9-15(18-11-21(13)14)17(22)19-16-10-20-7-5-12(16)6-8-20/h1,3-4,9,11-12,16H,5-8,10H2,(H,19,22)/t16-/m0/s1 |
| InChIKey | DWEKIQVVCPZJHM-INIZCTEOSA-N |
| XLogP | 1.14 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|