C19H25NO4 — CID 102364695
ethyl (2S,5R,6S,8S)-5-methyl-1-oxo-6-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydropyrrolizine-2-carboxylate (PubChem CID 102364695) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl (2S,5R,6S,8S)-5-methyl-1-oxo-6-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydropyrrolizine-2-carboxylate.
| Compound Name | ethyl (2S,5R,6S,8S)-5-methyl-1-oxo-6-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydropyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 102364695 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl (2S,5R,6S,8S)-5-methyl-1-oxo-6-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydropyrrolizine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CN2[C@H](C)[C@@H](COCc3ccccc3)C[C@H]2C1=O |
| InChI | InChI=1S/C19H25NO4/c1-3-24-19(22)16-10-20-13(2)15(9-17(20)18(16)21)12-23-11-14-7-5-4-6-8-14/h4-8,13,15-17H,3,9-12H2,1-2H3/t13-,15-,16+,17+/m1/s1 |
| InChIKey | RSAMKRXTIBPOLM-SIXLDLHFSA-N |
| XLogP | 2.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|