benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate

C15H19NO2 — CID 54008213

IUPACbenzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate
SMILESO=C(OCc1ccccc1)C1C[C@@H]2CCCN2C1
InChIInChI=1S/C15H19NO2/c17-15(18-11-12-5-2-1-3-6-12)13-9-14-7-4-8-16(14)10-13/h1-3,5-6,13-14H,4,7-11H2/t13?,14-/m0/s1
InChIKeyKQKIKWMDTVAEBZ-KZUDCZAMSA-N
MW245.32 g/mol
LogP2.21
Rot. Bonds3

About benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate

benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate (PubChem CID 54008213) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate.

Molecular Properties

Compound Namebenzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate
PubChem CID54008213
Molecular FormulaC15H19NO2
Molecular Weight245.32 g/mol
Exact Mass245.14
IUPAC Namebenzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate
SMILESO=C(OCc1ccccc1)C1C[C@@H]2CCCN2C1
InChIInChI=1S/C15H19NO2/c17-15(18-11-12-5-2-1-3-6-12)13-9-14-7-4-8-16(14)10-13/h1-3,5-6,13-14H,4,7-11H2/t13?,14-/m0/s1
InChIKeyKQKIKWMDTVAEBZ-KZUDCZAMSA-N
XLogP2.21
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.32
LogP ≤ 52.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate?
The IUPAC name of benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate (CID 54008213) is benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate.
What is the SMILES notation for benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate?
The canonical SMILES for benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate is O=C(OCc1ccccc1)C1C[C@@H]2CCCN2C1.
What is the InChIKey of benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate?
The InChIKey is KQKIKWMDTVAEBZ-KZUDCZAMSA-N. The full InChI is InChI=1S/C15H19NO2/c17-15(18-11-12-5-2-1-3-6-12)13-9-14-7-4-8-16(14)10-13/h1-3,5-6,13-14H,4,7-11H2/t13?,14-/m0/s1.
What are the key properties of benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate?
benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate has a molecular weight of 245.32 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate is sourced from PubChem (CID 54008213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).