C15H19NO2 — CID 54008213
benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate (PubChem CID 54008213) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate.
| Compound Name | benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 54008213 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | benzyl (8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1C[C@@H]2CCCN2C1 |
| InChI | InChI=1S/C15H19NO2/c17-15(18-11-12-5-2-1-3-6-12)13-9-14-7-4-8-16(14)10-13/h1-3,5-6,13-14H,4,7-11H2/t13?,14-/m0/s1 |
| InChIKey | KQKIKWMDTVAEBZ-KZUDCZAMSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |