C20H28FN2O4+ — CID 91444569
benzyl (3S,4R,8R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-2-carboxylate (PubChem CID 91444569) has the molecular formula C20H28FN2O4+ and a molecular weight of 379.45 g/mol. Its IUPAC name is benzyl (3S,4R,8R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-2-carboxylate.
| Compound Name | benzyl (3S,4R,8R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-2-carboxylate |
|---|---|
| PubChem CID | 91444569 |
| Molecular Formula | C20H28FN2O4+ |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | benzyl (3S,4R,8R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[N@+]12CCC[C@@H]1CC(C(=O)OCc1ccccc1)[C@@H]2F |
| InChI | InChI=1S/C20H27FN2O4/c1-20(2,3)27-19(25)22-23-11-7-10-15(23)12-16(17(23)21)18(24)26-13-14-8-5-4-6-9-14/h4-6,8-9,15-17H,7,10-13H2,1-3H3/p+1/t15-,16?,17-,23-/m1/s1 |
| InChIKey | YLVSQXPEOVFSBB-NPSRPMSXSA-O |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|