C16H21O6P — CID 102364757
2-[(R)-diethoxyphosphoryl-hydroxy-(2-methylphenyl)methyl]-2H-furan-5-one (PubChem CID 102364757) has the molecular formula C16H21O6P and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-[(R)-diethoxyphosphoryl-hydroxy-(2-methylphenyl)methyl]-2H-furan-5-one.
| Compound Name | 2-[(R)-diethoxyphosphoryl-hydroxy-(2-methylphenyl)methyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 102364757 |
| Molecular Formula | C16H21O6P |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[(R)-diethoxyphosphoryl-hydroxy-(2-methylphenyl)methyl]-2H-furan-5-one |
| SMILES | CCOP(=O)(OCC)[C@](O)(c1ccccc1C)C1C=CC(=O)O1 |
| InChI | InChI=1S/C16H21O6P/c1-4-20-23(19,21-5-2)16(18,14-10-11-15(17)22-14)13-9-7-6-8-12(13)3/h6-11,14,18H,4-5H2,1-3H3/t14?,16-/m1/s1 |
| InChIKey | CGWHVLUAGAIADF-BZSJEYESSA-N |
| XLogP | 2.89 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|