C27H29O8P — CID 71614011
ethyl (6S)-2-diphenoxyphosphoryloxy-4,4-dimethyl-6-[(2R)-5-oxo-2H-furan-2-yl]cyclohexene-1-carboxylate (PubChem CID 71614011) has the molecular formula C27H29O8P and a molecular weight of 512.50 g/mol. Its IUPAC name is ethyl (6S)-2-diphenoxyphosphoryloxy-4,4-dimethyl-6-[(2R)-5-oxo-2H-furan-2-yl]cyclohexene-1-carboxylate.
| Compound Name | ethyl (6S)-2-diphenoxyphosphoryloxy-4,4-dimethyl-6-[(2R)-5-oxo-2H-furan-2-yl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 71614011 |
| Molecular Formula | C27H29O8P |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | ethyl (6S)-2-diphenoxyphosphoryloxy-4,4-dimethyl-6-[(2R)-5-oxo-2H-furan-2-yl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(OP(=O)(Oc2ccccc2)Oc2ccccc2)CC(C)(C)C[C@@H]1[C@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C27H29O8P/c1-4-31-26(29)25-21(22-15-16-24(28)32-22)17-27(2,3)18-23(25)35-36(30,33-19-11-7-5-8-12-19)34-20-13-9-6-10-14-20/h5-16,21-22H,4,17-18H2,1-3H3/t21-,22-/m1/s1 |
| InChIKey | ZFMFWJKWMJVDLI-FGZHOGPDSA-N |
| XLogP | 6.00 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|