C18H20N4O — CID 10236578
N'-[7-(3-methoxyphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine (PubChem CID 10236578) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is N'-[7-(3-methoxyphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[7-(3-methoxyphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10236578 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N'-[7-(3-methoxyphenyl)-1,6-naphthyridin-5-yl]propane-1,3-diamine |
| SMILES | COc1cccc(-c2cc3ncccc3c(NCCCN)n2)c1 |
| InChI | InChI=1S/C18H20N4O/c1-23-14-6-2-5-13(11-14)16-12-17-15(7-3-9-20-17)18(22-16)21-10-4-8-19/h2-3,5-7,9,11-12H,4,8,10,19H2,1H3,(H,21,22) |
| InChIKey | WAWQOZCSROOCQK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|