About (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione
(1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione (PubChem CID 102367121) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione.
Molecular Properties
| Compound Name | (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione |
| PubChem CID | 102367121 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione |
| SMILES | COc1ccc(CN2[C@@H]3CCCC(=O)[C@H]2C(=O)C3)cc1 |
| InChI | InChI=1S/C16H19NO3/c1-20-13-7-5-11(6-8-13)10-17-12-3-2-4-14(18)16(17)15(19)9-12/h5-8,12,16H,2-4,9-10H2,1H3/t12-,16+/m1/s1 |
| InChIKey | SQKBHNQSXRQHKN-WBMJQRKESA-N |
| XLogP | 1.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione?
The IUPAC name of (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione (CID 102367121) is (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione.
What is the SMILES notation for (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione?
The canonical SMILES for (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione is COc1ccc(CN2[C@@H]3CCCC(=O)[C@H]2C(=O)C3)cc1.
What is the InChIKey of (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione?
The InChIKey is SQKBHNQSXRQHKN-WBMJQRKESA-N. The full InChI is InChI=1S/C16H19NO3/c1-20-13-7-5-11(6-8-13)10-17-12-3-2-4-14(18)16(17)15(19)9-12/h5-8,12,16H,2-4,9-10H2,1H3/t12-,16+/m1/s1.
What are the key properties of (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione?
(1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione has a molecular weight of 273.33 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-9-[(4-methoxyphenyl)methyl]-9-azabicyclo[4.2.1]nonane-2,8-dione is sourced from PubChem (CID 102367121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).