C19H25NO2 — CID 138678678
2,6-dicyclopropyl-1-[(4-methoxyphenyl)methyl]piperidin-4-one (PubChem CID 138678678) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2,6-dicyclopropyl-1-[(4-methoxyphenyl)methyl]piperidin-4-one.
| Compound Name | 2,6-dicyclopropyl-1-[(4-methoxyphenyl)methyl]piperidin-4-one |
|---|---|
| PubChem CID | 138678678 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2,6-dicyclopropyl-1-[(4-methoxyphenyl)methyl]piperidin-4-one |
| SMILES | COc1ccc(CN2C(C3CC3)CC(=O)CC2C2CC2)cc1 |
| InChI | InChI=1S/C19H25NO2/c1-22-17-8-2-13(3-9-17)12-20-18(14-4-5-14)10-16(21)11-19(20)15-6-7-15/h2-3,8-9,14-15,18-19H,4-7,10-12H2,1H3 |
| InChIKey | DYHHYQTVUNORLY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |