C13H18FN5O2S — CID 10236743
2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(2-fluoroethylsulfanylmethyl)pyrrolidine-3,4-diol (PubChem CID 10236743) has the molecular formula C13H18FN5O2S and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(2-fluoroethylsulfanylmethyl)pyrrolidine-3,4-diol.
| Compound Name | 2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(2-fluoroethylsulfanylmethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 10236743 |
| Molecular Formula | C13H18FN5O2S |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-5-(2-fluoroethylsulfanylmethyl)pyrrolidine-3,4-diol |
| SMILES | Nc1ncnc2c(C3NC(CSCCF)C(O)C3O)c[nH]c12 |
| InChI | InChI=1S/C13H18FN5O2S/c14-1-2-22-4-7-11(20)12(21)9(19-7)6-3-16-10-8(6)17-5-18-13(10)15/h3,5,7,9,11-12,16,19-21H,1-2,4H2,(H2,15,17,18) |
| InChIKey | QICCFKVSQMCTAZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|