C11H14IN5O3 — CID 129146423
[(2R,3R,4S,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,4-dihydroxypyrrolidin-2-yl]methyl hypoiodite (PubChem CID 129146423) has the molecular formula C11H14IN5O3 and a molecular weight of 391.17 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,4-dihydroxypyrrolidin-2-yl]methyl hypoiodite.
| Compound Name | [(2R,3R,4S,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,4-dihydroxypyrrolidin-2-yl]methyl hypoiodite |
|---|---|
| PubChem CID | 129146423 |
| Molecular Formula | C11H14IN5O3 |
| Molecular Weight | 391.17 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | [(2R,3R,4S,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-3,4-dihydroxypyrrolidin-2-yl]methyl hypoiodite |
| SMILES | Nc1ncnc2c([C@@H]3N[C@H](COI)[C@@H](O)[C@H]3O)c[nH]c12 |
| InChI | InChI=1S/C11H14IN5O3/c12-20-2-5-9(18)10(19)7(17-5)4-1-14-8-6(4)15-3-16-11(8)13/h1,3,5,7,9-10,14,17-19H,2H2,(H2,13,15,16)/t5-,7+,9-,10+/m1/s1 |
| InChIKey | FHVZKWZTVYJQPE-KUBHLMPHSA-N |
| XLogP | -0.36 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.17 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|