C17H20N6O2S — CID 46190570
(2S,3R,4S,5S)-2-[(3-aminophenyl)sulfanylmethyl]-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-3,4-diol (PubChem CID 46190570) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[(3-aminophenyl)sulfanylmethyl]-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3R,4S,5S)-2-[(3-aminophenyl)sulfanylmethyl]-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 46190570 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (2S,3R,4S,5S)-2-[(3-aminophenyl)sulfanylmethyl]-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-3,4-diol |
| SMILES | Nc1cccc(SC[C@H]2N[C@@H](c3c[nH]c4c(N)ncnc34)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C17H20N6O2S/c18-8-2-1-3-9(4-8)26-6-11-15(24)16(25)13(23-11)10-5-20-14-12(10)21-7-22-17(14)19/h1-5,7,11,13,15-16,20,23-25H,6,18H2,(H2,19,21,22)/t11-,13+,15-,16+/m1/s1 |
| InChIKey | OETPLIPEDBHECE-JMGFVUJMSA-N |
| XLogP | 0.65 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|