C26H28N4O5 — CID 102367915
N-cyclopentyl-3-hydroxy-2-(3-nitro-4-piperidin-1-ylphenyl)-4-oxo-1H-quinoline-7-carboxamide (PubChem CID 102367915) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-cyclopentyl-3-hydroxy-2-(3-nitro-4-piperidin-1-ylphenyl)-4-oxo-1H-quinoline-7-carboxamide.
| Compound Name | N-cyclopentyl-3-hydroxy-2-(3-nitro-4-piperidin-1-ylphenyl)-4-oxo-1H-quinoline-7-carboxamide |
|---|---|
| PubChem CID | 102367915 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-cyclopentyl-3-hydroxy-2-(3-nitro-4-piperidin-1-ylphenyl)-4-oxo-1H-quinoline-7-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc2c(=O)c(O)c(-c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)[nH]c2c1 |
| InChI | InChI=1S/C26H28N4O5/c31-24-19-10-8-17(26(33)27-18-6-2-3-7-18)14-20(19)28-23(25(24)32)16-9-11-21(22(15-16)30(34)35)29-12-4-1-5-13-29/h8-11,14-15,18,32H,1-7,12-13H2,(H,27,33)(H,28,31) |
| InChIKey | RUQBVQJYEWAWCR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|