C28H23NO2 — CID 102368110
3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-2,5-diphenylcyclohex-2-en-1-one (PubChem CID 102368110) has the molecular formula C28H23NO2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-2,5-diphenylcyclohex-2-en-1-one.
| Compound Name | 3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-2,5-diphenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102368110 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-2,5-diphenylcyclohex-2-en-1-one |
| SMILES | Cc1oc(-c2ccccc2)nc1C1=C(c2ccccc2)C(=O)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C28H23NO2/c1-19-27(29-28(31-19)22-15-9-4-10-16-22)24-17-23(20-11-5-2-6-12-20)18-25(30)26(24)21-13-7-3-8-14-21/h2-16,23H,17-18H2,1H3 |
| InChIKey | QPXXCKVQAXICPN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |